ChemNet > CAS > 118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
| 상품명칭 |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
| 별명 |
2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| 분자식 |
C11H8BrClOS |
| 분자량 |
303.6026 |
| InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| cas번호 |
118337-33-0 |
| 분자 구조 |
![118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/348/34859.gif)
|
| 밀도 |
1.632g/cm3 |
| 녹는 점 |
94℃ |
| 비등점 |
396.2°C at 760 mmHg |
| 굴절 지수 |
1.676 |
| 인화점 |
193.4°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
